C20H17Cl3N4OS2 — CID 178128236
(E)-3-(5-methylthiophen-2-yl)-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]prop-2-enamide (PubChem CID 178128236) has the molecular formula C20H17Cl3N4OS2 and a molecular weight of 499.88 g/mol. Its IUPAC name is (E)-3-(5-methylthiophen-2-yl)-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-methylthiophen-2-yl)-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 178128236 |
| Molecular Formula | C20H17Cl3N4OS2 |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | (E)-3-(5-methylthiophen-2-yl)-N-[2,2,2-trichloro-1-(quinolin-8-ylcarbamothioylamino)ethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC(NC(=S)Nc2cccc3cccnc23)C(Cl)(Cl)Cl)s1 |
| InChI | InChI=1S/C20H17Cl3N4OS2/c1-12-7-8-14(30-12)9-10-16(28)26-18(20(21,22)23)27-19(29)25-15-6-2-4-13-5-3-11-24-17(13)15/h2-11,18H,1H3,(H,26,28)(H2,25,27,29)/b10-9+ |
| InChIKey | KLRLPXPIYUQHAB-MDZDMXLPSA-N |
| XLogP | 5.42 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|