C18H14N2O — CID 952598
(E)-3-phenyl-N-quinolin-8-ylprop-2-enamide (PubChem CID 952598) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is (E)-3-phenyl-N-quinolin-8-ylprop-2-enamide.
| Compound Name | (E)-3-phenyl-N-quinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 952598 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (E)-3-phenyl-N-quinolin-8-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C18H14N2O/c21-17(12-11-14-6-2-1-3-7-14)20-16-10-4-8-15-9-5-13-19-18(15)16/h1-13H,(H,20,21)/b12-11+ |
| InChIKey | CTPSLLCFINSULA-VAWYXSNFSA-N |
| XLogP | 3.89 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|