C26H21N3O2 — CID 159458220
N-(3-methylphenyl)-3-[(E)-3-oxo-3-(quinolin-8-ylamino)prop-1-enyl]benzamide (PubChem CID 159458220) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-(3-methylphenyl)-3-[(E)-3-oxo-3-(quinolin-8-ylamino)prop-1-enyl]benzamide.
| Compound Name | N-(3-methylphenyl)-3-[(E)-3-oxo-3-(quinolin-8-ylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 159458220 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-(3-methylphenyl)-3-[(E)-3-oxo-3-(quinolin-8-ylamino)prop-1-enyl]benzamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(/C=C/C(=O)Nc3cccc4cccnc34)c2)c1 |
| InChI | InChI=1S/C26H21N3O2/c1-18-6-2-11-22(16-18)28-26(31)21-9-3-7-19(17-21)13-14-24(30)29-23-12-4-8-20-10-5-15-27-25(20)23/h2-17H,1H3,(H,28,31)(H,29,30)/b14-13+ |
| InChIKey | LUGFRFIZVSUQJG-BUHFOSPRSA-N |
| XLogP | 5.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|