C28H20F3N3O2 — CID 155125535
3-[3-oxo-3-(2-pyridin-2-ylanilino)prop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 155125535) has the molecular formula C28H20F3N3O2 and a molecular weight of 487.48 g/mol. Its IUPAC name is 3-[3-oxo-3-(2-pyridin-2-ylanilino)prop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[3-oxo-3-(2-pyridin-2-ylanilino)prop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 155125535 |
| Molecular Formula | C28H20F3N3O2 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 3-[3-oxo-3-(2-pyridin-2-ylanilino)prop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(C=Cc1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1)Nc1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C28H20F3N3O2/c29-28(30,31)21-9-6-10-22(18-21)33-27(36)20-8-5-7-19(17-20)14-15-26(35)34-25-13-2-1-11-23(25)24-12-3-4-16-32-24/h1-18H,(H,33,36)(H,34,35) |
| InChIKey | FGJTZNIDHXCFDR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|