C23H19ClF3N3O5S — CID 155125685
3-[(E)-3-[(5-chloropyridin-1-ium-2-yl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide;methanesulfonate (PubChem CID 155125685) has the molecular formula C23H19ClF3N3O5S and a molecular weight of 541.94 g/mol. Its IUPAC name is 3-[(E)-3-[(5-chloropyridin-1-ium-2-yl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide;methanesulfonate.
| Compound Name | 3-[(E)-3-[(5-chloropyridin-1-ium-2-yl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide;methanesulfonate |
|---|---|
| PubChem CID | 155125685 |
| Molecular Formula | C23H19ClF3N3O5S |
| Molecular Weight | 541.94 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 3-[(E)-3-[(5-chloropyridin-1-ium-2-yl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]benzamide;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].O=C(/C=C/c1cccc(C(=O)Nc2cccc(C(F)(F)F)c2)c1)Nc1ccc(Cl)c[nH+]1 |
| InChI | InChI=1S/C22H15ClF3N3O2.CH4O3S/c23-17-8-9-19(27-13-17)29-20(30)10-7-14-3-1-4-15(11-14)21(31)28-18-6-2-5-16(12-18)22(24,25)26;1-5(2,3)4/h1-13H,(H,28,31)(H,27,29,30);1H3,(H,2,3,4)/b10-7+; |
| InChIKey | QJGYZMZOHYUAAU-HCUGZAAXSA-N |
| XLogP | 4.24 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.94 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|