C22H15Cl2F3N2O3S — CID 3482582
N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 3482582) has the molecular formula C22H15Cl2F3N2O3S and a molecular weight of 515.34 g/mol. Its IUPAC name is N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3482582 |
| Molecular Formula | C22H15Cl2F3N2O3S |
| Molecular Weight | 515.34 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | N-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1)Nc1ccc(Cl)c(S(=O)(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H15Cl2F3N2O3S/c23-16-5-7-17(8-6-16)29-33(31,32)20-13-18(9-10-19(20)24)28-21(30)11-4-14-2-1-3-15(12-14)22(25,26)27/h1-13,29H,(H,28,30) |
| InChIKey | IMAIAVOPAKKUDS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.34 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|