C21H15Cl2FN2O3S — CID 3395431
N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 3395431) has the molecular formula C21H15Cl2FN2O3S and a molecular weight of 465.33 g/mol. Its IUPAC name is N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3395431 |
| Molecular Formula | C21H15Cl2FN2O3S |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.02 |
| IUPAC Name | N-[4-chloro-3-[(2-chlorophenyl)sulfamoyl]phenyl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(F)c1)Nc1ccc(Cl)c(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C21H15Cl2FN2O3S/c22-17-6-1-2-7-19(17)26-30(28,29)20-13-16(9-10-18(20)23)25-21(27)11-8-14-4-3-5-15(24)12-14/h1-13,26H,(H,25,27) |
| InChIKey | MPXWEJGWTBIRHE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|