C23H19ClN4O5S — CID 4843804
5-[3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoylamino]benzene-1,3-dicarboxamide (PubChem CID 4843804) has the molecular formula C23H19ClN4O5S and a molecular weight of 498.95 g/mol. Its IUPAC name is 5-[3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoylamino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 4843804 |
| Molecular Formula | C23H19ClN4O5S |
| Molecular Weight | 498.95 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | 5-[3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoylamino]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(NC(=O)C=Cc2ccc(S(=O)(=O)Nc3ccccc3Cl)cc2)cc(C(N)=O)c1 |
| InChI | InChI=1S/C23H19ClN4O5S/c24-19-3-1-2-4-20(19)28-34(32,33)18-8-5-14(6-9-18)7-10-21(29)27-17-12-15(22(25)30)11-16(13-17)23(26)31/h1-13,28H,(H2,25,30)(H2,26,31)(H,27,29) |
| InChIKey | RVJSUUUVMUATFD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 161.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.95 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|