C23H20ClFN2O3S — CID 26796001
(E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide (PubChem CID 26796001) has the molecular formula C23H20ClFN2O3S and a molecular weight of 458.94 g/mol. Its IUPAC name is (E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26796001 |
| Molecular Formula | C23H20ClFN2O3S |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]-N-[2-(4-fluorophenyl)ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20ClFN2O3S/c24-21-3-1-2-4-22(21)27-31(29,30)20-12-7-17(8-13-20)9-14-23(28)26-16-15-18-5-10-19(25)11-6-18/h1-14,27H,15-16H2,(H,26,28)/b14-9+ |
| InChIKey | ULVLYEGIKCPUDD-NTEUORMPSA-N |
| XLogP | 4.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|