C20H21ClN2O5S — CID 56551023
propan-2-yl 2-[[(E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoyl]amino]acetate (PubChem CID 56551023) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is propan-2-yl 2-[[(E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoyl]amino]acetate.
| Compound Name | propan-2-yl 2-[[(E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 56551023 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | propan-2-yl 2-[[(E)-3-[4-[(2-chlorophenyl)sulfamoyl]phenyl]prop-2-enoyl]amino]acetate |
| SMILES | CC(C)OC(=O)CNC(=O)/C=C/c1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O5S/c1-14(2)28-20(25)13-22-19(24)12-9-15-7-10-16(11-8-15)29(26,27)23-18-6-4-3-5-17(18)21/h3-12,14,23H,13H2,1-2H3,(H,22,24)/b12-9+ |
| InChIKey | JJCSFJFOUCZUGW-FMIVXFBMSA-N |
| XLogP | 3.22 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|