C22H25ClN2O3S — CID 42992234
N-(2-chlorophenyl)-4-[(E)-3-(3,5-dimethylpiperidin-1-yl)-3-oxoprop-1-enyl]benzenesulfonamide (PubChem CID 42992234) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[(E)-3-(3,5-dimethylpiperidin-1-yl)-3-oxoprop-1-enyl]benzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-4-[(E)-3-(3,5-dimethylpiperidin-1-yl)-3-oxoprop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42992234 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-(2-chlorophenyl)-4-[(E)-3-(3,5-dimethylpiperidin-1-yl)-3-oxoprop-1-enyl]benzenesulfonamide |
| SMILES | CC1CC(C)CN(C(=O)/C=C/c2ccc(S(=O)(=O)Nc3ccccc3Cl)cc2)C1 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-16-13-17(2)15-25(14-16)22(26)12-9-18-7-10-19(11-8-18)29(27,28)24-21-6-4-3-5-20(21)23/h3-12,16-17,24H,13-15H2,1-2H3/b12-9+ |
| InChIKey | IKWLKCLXZDZGBE-FMIVXFBMSA-N |
| XLogP | 4.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|