C16H22N2O4S — CID 94654483
4-[(Z)-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide (PubChem CID 94654483) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 4-[(Z)-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-[(Z)-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 94654483 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[(Z)-3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C\C(=O)N2C[C@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-12-10-18(11-13(2)22-12)16(19)9-6-14-4-7-15(8-5-14)23(20,21)17-3/h4-9,12-13,17H,10-11H2,1-3H3/b9-6-/t12-,13-/m0/s1 |
| InChIKey | OZMRQTFRKMUISI-LFCSJDMJSA-N |
| XLogP | 1.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|