C20H27N5O3S — CID 86906378
N-methyl-4-[(E)-3-oxo-3-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide (PubChem CID 86906378) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is N-methyl-4-[(E)-3-oxo-3-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide.
| Compound Name | N-methyl-4-[(E)-3-oxo-3-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86906378 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-methyl-4-[(E)-3-oxo-3-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-1-enyl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C/C(=O)N2CCCC(c3nncn3C(C)C)C2)cc1 |
| InChI | InChI=1S/C20H27N5O3S/c1-15(2)25-14-22-23-20(25)17-5-4-12-24(13-17)19(26)11-8-16-6-9-18(10-7-16)29(27,28)21-3/h6-11,14-15,17,21H,4-5,12-13H2,1-3H3/b11-8+ |
| InChIKey | MYZZHJYPKBUDNC-DHZHZOJOSA-N |
| XLogP | 2.19 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|