C17H26ClN3O3S — CID 126783366
4-[3-[2-(1-aminoethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide;hydrochloride (PubChem CID 126783366) has the molecular formula C17H26ClN3O3S and a molecular weight of 387.93 g/mol. Its IUPAC name is 4-[3-[2-(1-aminoethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-[3-[2-(1-aminoethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 126783366 |
| Molecular Formula | C17H26ClN3O3S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[3-[2-(1-aminoethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1ccc(C=CC(=O)N2CCCCC2C(C)N)cc1.Cl |
| InChI | InChI=1S/C17H25N3O3S.ClH/c1-13(18)16-5-3-4-12-20(16)17(21)11-8-14-6-9-15(10-7-14)24(22,23)19-2;/h6-11,13,16,19H,3-5,12,18H2,1-2H3;1H |
| InChIKey | NOTJPOWPXIHQOM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|