C17H25N3O3S — CID 126786221
4-[3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide (PubChem CID 126786221) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 4-[3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-[3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 126786221 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-[3-[2-(aminomethyl)-3-methylpiperidin-1-yl]-3-oxoprop-1-enyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C=CC(=O)N2CCCC(C)C2CN)cc1 |
| InChI | InChI=1S/C17H25N3O3S/c1-13-4-3-11-20(16(13)12-18)17(21)10-7-14-5-8-15(9-6-14)24(22,23)19-2/h5-10,13,16,19H,3-4,11-12,18H2,1-2H3 |
| InChIKey | MLNIKJWTCUFZMZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|