C26H30N4O2 — CID 86906381
(E)-3-(3-phenylmethoxyphenyl)-1-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 86906381) has the molecular formula C26H30N4O2 and a molecular weight of 430.55 g/mol. Its IUPAC name is (E)-3-(3-phenylmethoxyphenyl)-1-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-phenylmethoxyphenyl)-1-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 86906381 |
| Molecular Formula | C26H30N4O2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (E)-3-(3-phenylmethoxyphenyl)-1-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CC(C)n1cnnc1C1CCCN(C(=O)/C=C/c2cccc(OCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C26H30N4O2/c1-20(2)30-19-27-28-26(30)23-11-7-15-29(17-23)25(31)14-13-21-10-6-12-24(16-21)32-18-22-8-4-3-5-9-22/h3-6,8-10,12-14,16,19-20,23H,7,11,15,17-18H2,1-2H3/b14-13+ |
| InChIKey | DCJKDWNDFAXCAG-BUHFOSPRSA-N |
| XLogP | 4.86 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|