C22H26N2O2 — CID 78832553
(E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(3-phenylmethoxyphenyl)prop-2-en-1-one (PubChem CID 78832553) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(3-phenylmethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(3-phenylmethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78832553 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (E)-1-(4-methyl-1,4-diazepan-1-yl)-3-(3-phenylmethoxyphenyl)prop-2-en-1-one |
| SMILES | CN1CCCN(C(=O)/C=C/c2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H26N2O2/c1-23-13-6-14-24(16-15-23)22(25)12-11-19-9-5-10-21(17-19)26-18-20-7-3-2-4-8-20/h2-5,7-12,17H,6,13-16,18H2,1H3/b12-11+ |
| InChIKey | KKFHCKRHYUQUOS-VAWYXSNFSA-N |
| XLogP | 3.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|