C15H21N3O — CID 115342717
(E)-3-(3-aminophenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one (PubChem CID 115342717) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-aminophenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 115342717 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | (E)-3-(3-aminophenyl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one |
| SMILES | CN1CCCN(C(=O)/C=C/c2cccc(N)c2)CC1 |
| InChI | InChI=1S/C15H21N3O/c1-17-8-3-9-18(11-10-17)15(19)7-6-13-4-2-5-14(16)12-13/h2,4-7,12H,3,8-11,16H2,1H3/b7-6+ |
| InChIKey | HNILTRRXDAHSAF-VOTSOKGWSA-N |
| XLogP | 1.45 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|