C20H25N5O4 — CID 90541262
2-methyl-5-[1-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperidin-3-yl]-4-propan-2-yl-1,2,4-triazol-3-one (PubChem CID 90541262) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-methyl-5-[1-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperidin-3-yl]-4-propan-2-yl-1,2,4-triazol-3-one.
| Compound Name | 2-methyl-5-[1-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperidin-3-yl]-4-propan-2-yl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 90541262 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-methyl-5-[1-[(E)-3-(4-nitrophenyl)prop-2-enoyl]piperidin-3-yl]-4-propan-2-yl-1,2,4-triazol-3-one |
| SMILES | CC(C)n1c(C2CCCN(C(=O)/C=C/c3ccc([N+](=O)[O-])cc3)C2)nn(C)c1=O |
| InChI | InChI=1S/C20H25N5O4/c1-14(2)24-19(21-22(3)20(24)27)16-5-4-12-23(13-16)18(26)11-8-15-6-9-17(10-7-15)25(28)29/h6-11,14,16H,4-5,12-13H2,1-3H3/b11-8+ |
| InChIKey | GOZNJIFSOQRYEQ-DHZHZOJOSA-N |
| XLogP | 2.49 |
| TPSA | 103.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|