C22H19FN4O3S — CID 90491127
(E)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 90491127) has the molecular formula C22H19FN4O3S and a molecular weight of 438.48 g/mol. Its IUPAC name is (E)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90491127 |
| Molecular Formula | C22H19FN4O3S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (E)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N1CCCC(c2nnc(-c3ccccc3F)s2)C1 |
| InChI | InChI=1S/C22H19FN4O3S/c23-19-6-2-1-5-18(19)22-25-24-21(31-22)16-4-3-13-26(14-16)20(28)12-9-15-7-10-17(11-8-15)27(29)30/h1-2,5-12,16H,3-4,13-14H2/b12-9+ |
| InChIKey | UICDVNNQMXXAEE-FMIVXFBMSA-N |
| XLogP | 4.67 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|