C22H19ClFN3OS — CID 71793094
(E)-3-(2-chlorophenyl)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 71793094) has the molecular formula C22H19ClFN3OS and a molecular weight of 427.93 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 71793094 |
| Molecular Formula | C22H19ClFN3OS |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[3-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)N1CCCC(c2nnc(-c3ccccc3F)s2)C1 |
| InChI | InChI=1S/C22H19ClFN3OS/c23-18-9-3-1-6-15(18)11-12-20(28)27-13-5-7-16(14-27)21-25-26-22(29-21)17-8-2-4-10-19(17)24/h1-4,6,8-12,16H,5,7,13-14H2/b12-11+ |
| InChIKey | DWAKNGIVMOAJDH-VAWYXSNFSA-N |
| XLogP | 5.42 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|