C18H24N4O2S — CID 90541122
2-methyl-4-propan-2-yl-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,2,4-triazol-3-one (PubChem CID 90541122) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-methyl-4-propan-2-yl-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,2,4-triazol-3-one.
| Compound Name | 2-methyl-4-propan-2-yl-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 90541122 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-methyl-4-propan-2-yl-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-3-yl]-1,2,4-triazol-3-one |
| SMILES | CC(C)n1c(C2CCCN(C(=O)/C=C/c3cccs3)C2)nn(C)c1=O |
| InChI | InChI=1S/C18H24N4O2S/c1-13(2)22-17(19-20(3)18(22)24)14-6-4-10-21(12-14)16(23)9-8-15-7-5-11-25-15/h5,7-9,11,13-14H,4,6,10,12H2,1-3H3/b9-8+ |
| InChIKey | CNBFFJZTGBQHJI-CMDGGOBGSA-N |
| XLogP | 2.64 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|