C19H19ClN2O4S2 — CID 56571495
N-(2-chlorophenyl)-4-[(E)-3-oxo-3-(1-oxo-1,4-thiazinan-4-yl)prop-1-enyl]benzenesulfonamide (PubChem CID 56571495) has the molecular formula C19H19ClN2O4S2 and a molecular weight of 438.96 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[(E)-3-oxo-3-(1-oxo-1,4-thiazinan-4-yl)prop-1-enyl]benzenesulfonamide.
| Compound Name | N-(2-chlorophenyl)-4-[(E)-3-oxo-3-(1-oxo-1,4-thiazinan-4-yl)prop-1-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56571495 |
| Molecular Formula | C19H19ClN2O4S2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-(2-chlorophenyl)-4-[(E)-3-oxo-3-(1-oxo-1,4-thiazinan-4-yl)prop-1-enyl]benzenesulfonamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1)N1CCS(=O)CC1 |
| InChI | InChI=1S/C19H19ClN2O4S2/c20-17-3-1-2-4-18(17)21-28(25,26)16-8-5-15(6-9-16)7-10-19(23)22-11-13-27(24)14-12-22/h1-10,21H,11-14H2/b10-7+ |
| InChIKey | IDEBJBNGLYQOFS-JXMROGBWSA-N |
| XLogP | 2.74 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|