C21H16F2N2O3S — CID 4105329
3-(4-fluorophenyl)-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enamide (PubChem CID 4105329) has the molecular formula C21H16F2N2O3S and a molecular weight of 414.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4105329 |
| Molecular Formula | C21H16F2N2O3S |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)Nc1ccccc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H16F2N2O3S/c22-16-8-5-15(6-9-16)7-14-21(26)24-19-3-1-2-4-20(19)25-29(27,28)18-12-10-17(23)11-13-18/h1-14,25H,(H,24,26) |
| InChIKey | OXUTXAYHQIOBKX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|