C23H21FN2O3S — CID 4934055
N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 4934055) has the molecular formula C23H21FN2O3S and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4934055 |
| Molecular Formula | C23H21FN2O3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=O)C=Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H21FN2O3S/c1-16-4-3-5-17(2)23(16)26-30(28,29)21-13-11-20(12-14-21)25-22(27)15-8-18-6-9-19(24)10-7-18/h3-15,26H,1-2H3,(H,25,27) |
| InChIKey | NNOCUBUWNDWQKR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|