C26H24N4O3S — CID 55864211
(E)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 55864211) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is (E)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55864211 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (E)-N-[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=O)/C=C/c2cnn(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H24N4O3S/c1-19-7-6-8-20(2)26(19)29-34(32,33)24-14-12-22(13-15-24)28-25(31)16-11-21-17-27-30(18-21)23-9-4-3-5-10-23/h3-18,29H,1-2H3,(H,28,31)/b16-11+ |
| InChIKey | PRVXXEDWFKCVPI-LFIBNONCSA-N |
| XLogP | 4.94 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|