C23H17N5OS — CID 46635889
(E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide (PubChem CID 46635889) has the molecular formula C23H17N5OS and a molecular weight of 411.49 g/mol. Its IUPAC name is (E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46635889 |
| Molecular Formula | C23H17N5OS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (E)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-3-(1-phenylpyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cnn(-c2ccccc2)c1)Nc1ccc(-c2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C23H17N5OS/c29-22(11-6-17-14-24-28(15-17)20-4-2-1-3-5-20)25-19-9-7-18(8-10-19)21-16-27-12-13-30-23(27)26-21/h1-16H,(H,25,29)/b11-6+ |
| InChIKey | NLKZNCAXYYIHPA-IZZDOVSWSA-N |
| XLogP | 4.90 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|