C18H13N3O2S — CID 37039072
2-hydroxy-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide (PubChem CID 37039072) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-hydroxy-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide.
| Compound Name | 2-hydroxy-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
|---|---|
| PubChem CID | 37039072 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-hydroxy-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(-c2cn3ccsc3n2)cc1)c1ccccc1O |
| InChI | InChI=1S/C18H13N3O2S/c22-16-4-2-1-3-14(16)17(23)19-13-7-5-12(6-8-13)15-11-21-9-10-24-18(21)20-15/h1-11,22H,(H,19,23) |
| InChIKey | AYWAYXWYPOVZAL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |