C17H12N4O2S — CID 37039109
N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 37039109) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 37039109 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cn3ccsc3n2)cc1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C17H12N4O2S/c22-16(13-5-7-21(23)8-6-13)18-14-3-1-12(2-4-14)15-11-20-9-10-24-17(20)19-15/h1-11H,(H,18,22) |
| InChIKey | IMODCDYSOVNNLD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|