C22H16N4O3S — CID 29441698
3-(2,5-dioxopyrrolidin-1-yl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide (PubChem CID 29441698) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
|---|---|
| PubChem CID | 29441698 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(-c2cn3ccsc3n2)cc1)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C22H16N4O3S/c27-19-8-9-20(28)26(19)17-3-1-2-15(12-17)21(29)23-16-6-4-14(5-7-16)18-13-25-10-11-30-22(25)24-18/h1-7,10-13H,8-9H2,(H,23,29) |
| InChIKey | GYTNIXCKUWIBJJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|