C28H20N4O3S — CID 26175525
2-(2,5-dimethylphenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 26175525) has the molecular formula C28H20N4O3S and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 26175525 |
| Molecular Formula | C28H20N4O3S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-(4-imidazo[2,1-b][1,3]thiazol-6-ylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)Nc4ccc(-c5cn6ccsc6n5)cc4)cc3C2=O)c1 |
| InChI | InChI=1S/C28H20N4O3S/c1-16-3-4-17(2)24(13-16)32-26(34)21-10-7-19(14-22(21)27(32)35)25(33)29-20-8-5-18(6-9-20)23-15-31-11-12-36-28(31)30-23/h3-15H,1-2H3,(H,29,33) |
| InChIKey | CCTNUGYOOVCKMN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|