C29H25N3O3S — CID 16550154
2-(2,5-dimethylphenyl)-1,3-dioxo-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide (PubChem CID 16550154) has the molecular formula C29H25N3O3S and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,3-dioxo-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide.
| Compound Name | 2-(2,5-dimethylphenyl)-1,3-dioxo-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 16550154 |
| Molecular Formula | C29H25N3O3S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,3-dioxo-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]isoindole-5-carboxamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)c3ccc4c(c3)C(=O)N(c3cc(C)ccc3C)C4=O)n2)c(C)c1 |
| InChI | InChI=1S/C29H25N3O3S/c1-15-6-7-17(3)24(12-15)32-27(34)21-9-8-20(13-22(21)28(32)35)26(33)31-29-30-23(14-36-29)25-18(4)10-16(2)11-19(25)5/h6-14H,1-5H3,(H,30,31,33) |
| InChIKey | YGGXSGKYQVFPBL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|