C23H16Cl2N2O3 — CID 26720485
N-(2,4-dichlorophenyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 26720485) has the molecular formula C23H16Cl2N2O3 and a molecular weight of 439.30 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 26720485 |
| Molecular Formula | C23H16Cl2N2O3 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)Nc4ccc(Cl)cc4Cl)cc3C2=O)c1 |
| InChI | InChI=1S/C23H16Cl2N2O3/c1-12-3-4-13(2)20(9-12)27-22(29)16-7-5-14(10-17(16)23(27)30)21(28)26-19-8-6-15(24)11-18(19)25/h3-11H,1-2H3,(H,26,28) |
| InChIKey | BRVXWZGNXZQEJC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|