C25H23N3O5S — CID 55985232
2-(2,5-dimethylphenyl)-N-[2-(dimethylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55985232) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-[2-(dimethylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-[2-(dimethylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55985232 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-[2-(dimethylsulfamoyl)phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)Nc4ccccc4S(=O)(=O)N(C)C)cc3C2=O)c1 |
| InChI | InChI=1S/C25H23N3O5S/c1-15-9-10-16(2)21(13-15)28-24(30)18-12-11-17(14-19(18)25(28)31)23(29)26-20-7-5-6-8-22(20)34(32,33)27(3)4/h5-14H,1-4H3,(H,26,29) |
| InChIKey | KNHYDWKXWNOACV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|