C29H29N3O5S — CID 3639161
2-(2,5-dimethylphenyl)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 3639161) has the molecular formula C29H29N3O5S and a molecular weight of 531.63 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2,5-dimethylphenyl)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 3639161 |
| Molecular Formula | C29H29N3O5S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)Nc4cc(S(=O)(=O)N5CCCCC5)ccc4C)cc3C2=O)c1 |
| InChI | InChI=1S/C29H29N3O5S/c1-18-7-8-20(3)26(15-18)32-28(34)23-12-10-21(16-24(23)29(32)35)27(33)30-25-17-22(11-9-19(25)2)38(36,37)31-13-5-4-6-14-31/h7-12,15-17H,4-6,13-14H2,1-3H3,(H,30,33) |
| InChIKey | AHTMATRUAKMECK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|