C28H27N3O5S — CID 4850262
2-(2,5-dimethylphenyl)-5-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 4850262) has the molecular formula C28H27N3O5S and a molecular weight of 517.61 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-5-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(2,5-dimethylphenyl)-5-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4850262 |
| Molecular Formula | C28H27N3O5S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-5-[4-(4-methylphenyl)sulfonylpiperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc4c(c3)C(=O)N(c3cc(C)ccc3C)C4=O)CC2)cc1 |
| InChI | InChI=1S/C28H27N3O5S/c1-18-5-9-22(10-6-18)37(35,36)30-14-12-29(13-15-30)26(32)21-8-11-23-24(17-21)28(34)31(27(23)33)25-16-19(2)4-7-20(25)3/h4-11,16-17H,12-15H2,1-3H3 |
| InChIKey | DAXDTRVOGNBEBR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|