C25H24N4O4 — CID 60525374
2-(2,5-dimethylphenyl)-5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]isoindole-1,3-dione (PubChem CID 60525374) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(2,5-dimethylphenyl)-5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 60525374 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)N4CCC(c5nc(C)no5)CC4)cc3C2=O)c1 |
| InChI | InChI=1S/C25H24N4O4/c1-14-4-5-15(2)21(12-14)29-24(31)19-7-6-18(13-20(19)25(29)32)23(30)28-10-8-17(9-11-28)22-26-16(3)27-33-22/h4-7,12-13,17H,8-11H2,1-3H3 |
| InChIKey | NPQOYWYRDBHWGI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|