C26H28N2O3 — CID 9489445
5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(2,5-dimethylphenyl)isoindole-1,3-dione (PubChem CID 9489445) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(2,5-dimethylphenyl)isoindole-1,3-dione.
| Compound Name | 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(2,5-dimethylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 9489445 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 5-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(2,5-dimethylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)N4CCC[C@@H]5CCCC[C@@H]54)cc3C2=O)c1 |
| InChI | InChI=1S/C26H28N2O3/c1-16-9-10-17(2)23(14-16)28-25(30)20-12-11-19(15-21(20)26(28)31)24(29)27-13-5-7-18-6-3-4-8-22(18)27/h9-12,14-15,18,22H,3-8,13H2,1-2H3/t18-,22-/m0/s1 |
| InChIKey | KYGBQUZOIGICBL-AVRDEDQJSA-N |
| XLogP | 4.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|