C28H29N3O3 — CID 112797566
2-(2,5-dimethylphenyl)-5-[2-(1-methylpyrrol-2-yl)azepane-1-carbonyl]isoindole-1,3-dione (PubChem CID 112797566) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-5-[2-(1-methylpyrrol-2-yl)azepane-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(2,5-dimethylphenyl)-5-[2-(1-methylpyrrol-2-yl)azepane-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 112797566 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-5-[2-(1-methylpyrrol-2-yl)azepane-1-carbonyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)N4CCCCCC4c4cccn4C)cc3C2=O)c1 |
| InChI | InChI=1S/C28H29N3O3/c1-18-10-11-19(2)25(16-18)31-27(33)21-13-12-20(17-22(21)28(31)34)26(32)30-15-6-4-5-8-24(30)23-9-7-14-29(23)3/h7,9-14,16-17,24H,4-6,8,15H2,1-3H3 |
| InChIKey | MMDJAAVBYZCFTL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|