C18H20ClFN2O — CID 51726529
(5-chloro-2-fluorophenyl)-[(2R)-2-(1-methylpyrrol-2-yl)azepan-1-yl]methanone (PubChem CID 51726529) has the molecular formula C18H20ClFN2O and a molecular weight of 334.82 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[(2R)-2-(1-methylpyrrol-2-yl)azepan-1-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[(2R)-2-(1-methylpyrrol-2-yl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 51726529 |
| Molecular Formula | C18H20ClFN2O |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[(2R)-2-(1-methylpyrrol-2-yl)azepan-1-yl]methanone |
| SMILES | Cn1cccc1[C@H]1CCCCCN1C(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C18H20ClFN2O/c1-21-10-5-7-16(21)17-6-3-2-4-11-22(17)18(23)14-12-13(19)8-9-15(14)20/h5,7-10,12,17H,2-4,6,11H2,1H3/t17-/m1/s1 |
| InChIKey | RSYXGYQOPHTBRH-QGZVFWFLSA-N |
| XLogP | 4.58 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |