C15H14ClFN2O — CID 47028453
(5-chloro-2-fluorophenyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 47028453) has the molecular formula C15H14ClFN2O and a molecular weight of 292.74 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 47028453 |
| Molecular Formula | C15H14ClFN2O |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1F)N1CCCC1c1ccc[nH]1 |
| InChI | InChI=1S/C15H14ClFN2O/c16-10-5-6-12(17)11(9-10)15(20)19-8-2-4-14(19)13-3-1-7-18-13/h1,3,5-7,9,14,18H,2,4,8H2 |
| InChIKey | SXAXFEUOQMLQOA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |