C14H14FN3O — CID 113240934
(3-fluoro-4-pyridinyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 113240934) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-fluoro-4-pyridinyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 113240934 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-[2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccncc1F)N1CCCC1c1ccc[nH]1 |
| InChI | InChI=1S/C14H14FN3O/c15-11-9-16-7-5-10(11)14(19)18-8-2-4-13(18)12-3-1-6-17-12/h1,3,5-7,9,13,17H,2,4,8H2 |
| InChIKey | XSIKFVZMLFGDLS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |