C18H18ClN3O — CID 95232987
2-(6-chloro-1H-indol-3-yl)-1-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone (PubChem CID 95232987) has the molecular formula C18H18ClN3O and a molecular weight of 327.81 g/mol. Its IUPAC name is 2-(6-chloro-1H-indol-3-yl)-1-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(6-chloro-1H-indol-3-yl)-1-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 95232987 |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-(6-chloro-1H-indol-3-yl)-1-[(2R)-2-(1H-pyrrol-2-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1c[nH]c2cc(Cl)ccc12)N1CCC[C@@H]1c1ccc[nH]1 |
| InChI | InChI=1S/C18H18ClN3O/c19-13-5-6-14-12(11-21-16(14)10-13)9-18(23)22-8-2-4-17(22)15-3-1-7-20-15/h1,3,5-7,10-11,17,20-21H,2,4,8-9H2/t17-/m1/s1 |
| InChIKey | WLYUBUWOSQPDQG-QGZVFWFLSA-N |
| XLogP | 4.06 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |