C29H28N4O4 — CID 166193661
1-[1-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-3-phenylurea (PubChem CID 166193661) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 1-[1-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 166193661 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 1-[1-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperidin-4-yl]-3-phenylurea |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)N4CCC(NC(=O)Nc5ccccc5)CC4)cc3C2=O)c1 |
| InChI | InChI=1S/C29H28N4O4/c1-18-8-9-19(2)25(16-18)33-27(35)23-11-10-20(17-24(23)28(33)36)26(34)32-14-12-22(13-15-32)31-29(37)30-21-6-4-3-5-7-21/h3-11,16-17,22H,12-15H2,1-2H3,(H2,30,31,37) |
| InChIKey | VCYLEEKOKMLXGY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|