C29H26N4O3 — CID 112798061
2-[4-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperazin-1-yl]-2-phenylacetonitrile (PubChem CID 112798061) has the molecular formula C29H26N4O3 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperazin-1-yl]-2-phenylacetonitrile.
| Compound Name | 2-[4-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperazin-1-yl]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 112798061 |
| Molecular Formula | C29H26N4O3 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 2-[4-[2-(2,5-dimethylphenyl)-1,3-dioxoisoindole-5-carbonyl]piperazin-1-yl]-2-phenylacetonitrile |
| SMILES | Cc1ccc(C)c(N2C(=O)c3ccc(C(=O)N4CCN(C(C#N)c5ccccc5)CC4)cc3C2=O)c1 |
| InChI | InChI=1S/C29H26N4O3/c1-19-8-9-20(2)25(16-19)33-28(35)23-11-10-22(17-24(23)29(33)36)27(34)32-14-12-31(13-15-32)26(18-30)21-6-4-3-5-7-21/h3-11,16-17,26H,12-15H2,1-2H3 |
| InChIKey | ATAHYYLFTKWOJJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|