C20H23N3O3 — CID 47070929
1-[1-(2-hydroxy-4-methylbenzoyl)piperidin-4-yl]-3-phenylurea (PubChem CID 47070929) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-[1-(2-hydroxy-4-methylbenzoyl)piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-(2-hydroxy-4-methylbenzoyl)piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 47070929 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[1-(2-hydroxy-4-methylbenzoyl)piperidin-4-yl]-3-phenylurea |
| SMILES | Cc1ccc(C(=O)N2CCC(NC(=O)Nc3ccccc3)CC2)c(O)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-14-7-8-17(18(24)13-14)19(25)23-11-9-16(10-12-23)22-20(26)21-15-5-3-2-4-6-15/h2-8,13,16,24H,9-12H2,1H3,(H2,21,22,26) |
| InChIKey | JAVWVUGJXZKRRM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |