C13H18N3OY- — CID 59803141
1-(1-methanidylpiperidin-4-yl)-3-phenylurea;yttrium (PubChem CID 59803141) has the molecular formula C13H18N3OY- and a molecular weight of 321.21 g/mol. Its IUPAC name is 1-(1-methanidylpiperidin-4-yl)-3-phenylurea;yttrium.
| Compound Name | 1-(1-methanidylpiperidin-4-yl)-3-phenylurea;yttrium |
|---|---|
| PubChem CID | 59803141 |
| Molecular Formula | C13H18N3OY- |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 1-(1-methanidylpiperidin-4-yl)-3-phenylurea;yttrium |
| SMILES | [CH2-]N1CCC(NC(=O)Nc2ccccc2)CC1.[Y] |
| InChI | InChI=1S/C13H18N3O.Y/c1-16-9-7-12(8-10-16)15-13(17)14-11-5-3-2-4-6-11;/h2-6,12H,1,7-10H2,(H2,14,15,17);/q-1; |
| InChIKey | PTOKEELDTZIAQM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|