C17H25N3O2 — CID 110638001
1-[1-(3-methylbutanoyl)piperidin-4-yl]-3-phenylurea (PubChem CID 110638001) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[1-(3-methylbutanoyl)piperidin-4-yl]-3-phenylurea.
| Compound Name | 1-[1-(3-methylbutanoyl)piperidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 110638001 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1-[1-(3-methylbutanoyl)piperidin-4-yl]-3-phenylurea |
| SMILES | CC(C)CC(=O)N1CCC(NC(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3O2/c1-13(2)12-16(21)20-10-8-15(9-11-20)19-17(22)18-14-6-4-3-5-7-14/h3-7,13,15H,8-12H2,1-2H3,(H2,18,19,22) |
| InChIKey | NHGGGLNUEBRWLD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |