C21H25N3OS — CID 94472172
1-(1-benzoylpiperidin-4-yl)-3-(2,5-dimethylphenyl)thiourea (PubChem CID 94472172) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(1-benzoylpiperidin-4-yl)-3-(2,5-dimethylphenyl)thiourea.
| Compound Name | 1-(1-benzoylpiperidin-4-yl)-3-(2,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 94472172 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-(1-benzoylpiperidin-4-yl)-3-(2,5-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NC2CCN(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3OS/c1-15-8-9-16(2)19(14-15)23-21(26)22-18-10-12-24(13-11-18)20(25)17-6-4-3-5-7-17/h3-9,14,18H,10-13H2,1-2H3,(H2,22,23,26) |
| InChIKey | VKHPZNZPMSYPGJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|