C17H27N3O2S2 — CID 43077031
1-(2,5-dimethylphenyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea (PubChem CID 43077031) has the molecular formula C17H27N3O2S2 and a molecular weight of 369.56 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 43077031 |
| Molecular Formula | C17H27N3O2S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(1-propylsulfonylpiperidin-4-yl)thiourea |
| SMILES | CCCS(=O)(=O)N1CCC(NC(=S)Nc2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C17H27N3O2S2/c1-4-11-24(21,22)20-9-7-15(8-10-20)18-17(23)19-16-12-13(2)5-6-14(16)3/h5-6,12,15H,4,7-11H2,1-3H3,(H2,18,19,23) |
| InChIKey | UWYFAIKYLXOOES-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|